N-[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
					Chemical Structure Depiction of
N-[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
			N-[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 7833-2703 | 
| Compound Name: | N-[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide | 
| Molecular Weight: | 454.91 | 
| Molecular Formula: | C27 H19 Cl N2 O3 | 
| Smiles: | Cc1ccc2c(c1)nc(c1cc(ccc1[Cl])NC(/C=C/c1ccc(c3ccccc3)o1)=O)o2 | 
| Stereo: | ACHIRAL | 
| logP: | 7.2247 | 
| logD: | 7.2247 | 
| logSw: | -6.4167 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 47.496 | 
| InChI Key: | MXSJOKGNXIOCHP-UHFFFAOYSA-N | 
 
				 
				