4-chloro-N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide
Chemical Structure Depiction of
4-chloro-N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide
4-chloro-N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide
Compound characteristics
| Compound ID: | 7840-3216 |
| Compound Name: | 4-chloro-N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide |
| Molecular Weight: | 407.81 |
| Molecular Formula: | C21 H14 Cl N3 O4 |
| Smiles: | Cc1ccc2c(c1)oc(c1cccc(c1)NC(c1ccc(c(c1)[N+]([O-])=O)[Cl])=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 5.2848 |
| logD: | 5.2831 |
| logSw: | -5.962 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.22 |
| InChI Key: | SYMOPAMKYPYGME-UHFFFAOYSA-N |