N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-2,4-dichlorobenzamide
Chemical Structure Depiction of
N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-2,4-dichlorobenzamide
N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-2,4-dichlorobenzamide
Compound characteristics
| Compound ID: | 7840-3247 |
| Compound Name: | N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-2,4-dichlorobenzamide |
| Molecular Weight: | 413.26 |
| Molecular Formula: | C21 H14 Cl2 N2 O3 |
| Smiles: | COc1ccc(cc1NC(c1ccc(cc1[Cl])[Cl])=O)c1nc2ccccc2o1 |
| Stereo: | ACHIRAL |
| logP: | 5.7326 |
| logD: | 5.7027 |
| logSw: | -5.9944 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.072 |
| InChI Key: | YKJLUGKPPARIAE-UHFFFAOYSA-N |