3,5-dichloro-N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-2-methoxybenzamide
Chemical Structure Depiction of
3,5-dichloro-N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-2-methoxybenzamide
3,5-dichloro-N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-2-methoxybenzamide
Compound characteristics
| Compound ID: | 7840-3845 |
| Compound Name: | 3,5-dichloro-N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-2-methoxybenzamide |
| Molecular Weight: | 431.25 |
| Molecular Formula: | C20 H13 Cl2 F N4 O2 |
| Smiles: | COc1c(cc(cc1[Cl])[Cl])C(Nc1ccc2c(c1)nn(c1ccc(cc1)F)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6783 |
| logD: | 4.05 |
| logSw: | -6.0459 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.081 |
| InChI Key: | UUGRKSYMSNWUGW-UHFFFAOYSA-N |