N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2,6-dimethoxybenzamide
Chemical Structure Depiction of
N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2,6-dimethoxybenzamide
N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2,6-dimethoxybenzamide
Compound characteristics
| Compound ID: | 7846-0883 |
| Compound Name: | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2,6-dimethoxybenzamide |
| Molecular Weight: | 420.49 |
| Molecular Formula: | C23 H20 N2 O4 S |
| Smiles: | COc1ccc(cc1NC(c1c(cccc1OC)OC)=O)c1nc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 4.6246 |
| logD: | 4.4477 |
| logSw: | -4.6711 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.972 |
| InChI Key: | CNUIOKVHEIWLLP-UHFFFAOYSA-N |