2-nitrophenyl 3-chloro-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
2-nitrophenyl 3-chloro-1-benzothiophene-2-carboxylate
2-nitrophenyl 3-chloro-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | 7884-0890 |
| Compound Name: | 2-nitrophenyl 3-chloro-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 333.75 |
| Molecular Formula: | C15 H8 Cl N O4 S |
| Smiles: | c1ccc(c(c1)[N+]([O-])=O)OC(c1c(c2ccccc2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.598 |
| logD: | 4.598 |
| logSw: | -4.9865 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.53 |
| InChI Key: | AMBLGWWFNAMRQO-UHFFFAOYSA-N |