N-(2,6-dichlorophenyl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-(2,6-dichlorophenyl)thiophene-2-carboxamide
N-(2,6-dichlorophenyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 8001-0396 |
| Compound Name: | N-(2,6-dichlorophenyl)thiophene-2-carboxamide |
| Molecular Weight: | 272.15 |
| Molecular Formula: | C11 H7 Cl2 N O S |
| Smiles: | c1cc(c(c(c1)[Cl])NC(c1cccs1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.9247 |
| logD: | 3.8773 |
| logSw: | -4.2094 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.9523 |
| InChI Key: | SUGOOMZCXWKVKV-UHFFFAOYSA-N |