4-methyl-N-phenyl-5-(2,2,2-trichloroethyl)-1,3-thiazol-2-amine
Chemical Structure Depiction of
4-methyl-N-phenyl-5-(2,2,2-trichloroethyl)-1,3-thiazol-2-amine
4-methyl-N-phenyl-5-(2,2,2-trichloroethyl)-1,3-thiazol-2-amine
Compound characteristics
| Compound ID: | 8001-1411 |
| Compound Name: | 4-methyl-N-phenyl-5-(2,2,2-trichloroethyl)-1,3-thiazol-2-amine |
| Molecular Weight: | 321.65 |
| Molecular Formula: | C12 H11 Cl3 N2 S |
| Smiles: | Cc1c(CC([Cl])([Cl])[Cl])sc(Nc2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.2189 |
| logD: | 5.1916 |
| logSw: | -5.6757 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 19.7741 |
| InChI Key: | BHGXNSYNSLZNBW-UHFFFAOYSA-N |