N-{4-[(4-hydroxyphenyl)carbamoyl]phenyl}-3-methylbenzamide
Chemical Structure Depiction of
N-{4-[(4-hydroxyphenyl)carbamoyl]phenyl}-3-methylbenzamide
N-{4-[(4-hydroxyphenyl)carbamoyl]phenyl}-3-methylbenzamide
Compound characteristics
| Compound ID: | 8001-3425 |
| Compound Name: | N-{4-[(4-hydroxyphenyl)carbamoyl]phenyl}-3-methylbenzamide |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C21 H18 N2 O3 |
| Smiles: | Cc1cccc(c1)C(Nc1ccc(cc1)C(Nc1ccc(cc1)O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6032 |
| logD: | 3.5685 |
| logSw: | -3.6797 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.038 |
| InChI Key: | URXIMWYTVPYVGI-UHFFFAOYSA-N |