2-(4-bromo-2-methoxyphenoxy)-N'-[1-(2-hydroxyphenyl)ethylidene]acetohydrazide
Chemical Structure Depiction of
2-(4-bromo-2-methoxyphenoxy)-N'-[1-(2-hydroxyphenyl)ethylidene]acetohydrazide
2-(4-bromo-2-methoxyphenoxy)-N'-[1-(2-hydroxyphenyl)ethylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8001-5251 |
| Compound Name: | 2-(4-bromo-2-methoxyphenoxy)-N'-[1-(2-hydroxyphenyl)ethylidene]acetohydrazide |
| Molecular Weight: | 393.24 |
| Molecular Formula: | C17 H17 Br N2 O4 |
| Smiles: | C\C(c1ccccc1O)=N/NC(COc1ccc(cc1OC)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.7638 |
| logD: | 3.7625 |
| logSw: | -3.3407 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.393 |
| InChI Key: | DIUMPNPKTJCQKQ-UHFFFAOYSA-N |