2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-5-[(2-fluorophenyl)methylidene]-1,3-thiazolidin-4-one
Chemical Structure Depiction of
2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-5-[(2-fluorophenyl)methylidene]-1,3-thiazolidin-4-one
2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-5-[(2-fluorophenyl)methylidene]-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8001-6900 |
| Compound Name: | 2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-5-[(2-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
| Molecular Weight: | 368.43 |
| Molecular Formula: | C19 H17 F N4 O S |
| Smiles: | CN(C)c1ccc(/C=N/N=C2\NC(/C(=C\c3ccccc3F)S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6997 |
| logD: | 3.682 |
| logSw: | -4.0569 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.224 |
| InChI Key: | JKOXARPBRSXPLH-UHFFFAOYSA-N |