3-bromo-6-methyl-4-(trifluoromethyl)[1,2]thiazolo[5,4-b]pyridine
Chemical Structure Depiction of
3-bromo-6-methyl-4-(trifluoromethyl)[1,2]thiazolo[5,4-b]pyridine
3-bromo-6-methyl-4-(trifluoromethyl)[1,2]thiazolo[5,4-b]pyridine
Compound characteristics
| Compound ID: | 8001-8245 |
| Compound Name: | 3-bromo-6-methyl-4-(trifluoromethyl)[1,2]thiazolo[5,4-b]pyridine |
| Molecular Weight: | 297.09 |
| Molecular Formula: | C8 H4 Br F3 N2 S |
| Smiles: | Cc1cc(c2c(nsc2n1)[Br])C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 3.565 |
| logD: | 3.565 |
| logSw: | -3.9989 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.3589 |
| InChI Key: | XXVIPNOTHSIXQJ-UHFFFAOYSA-N |