N-[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]-1-(2,4-dichlorophenyl)methanimine
Chemical Structure Depiction of
N-[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]-1-(2,4-dichlorophenyl)methanimine
N-[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]-1-(2,4-dichlorophenyl)methanimine
Compound characteristics
| Compound ID: | 8001-9177 |
| Compound Name: | N-[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]-1-(2,4-dichlorophenyl)methanimine |
| Molecular Weight: | 401.68 |
| Molecular Formula: | C20 H11 Cl3 N2 O |
| Smiles: | C(\c1ccc(cc1[Cl])[Cl])=N/c1ccc(c(c1)c1nc2ccccc2o1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.9548 |
| logD: | 6.9547 |
| logSw: | -6.8637 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.1761 |
| InChI Key: | NXADLVDOBWJQQG-UHFFFAOYSA-N |