4-({2-[(2,6-dibromo-4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Chemical Structure Depiction of
4-({2-[(2,6-dibromo-4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
4-({2-[(2,6-dibromo-4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Compound characteristics
| Compound ID: | 8001-9625 |
| Compound Name: | 4-({2-[(2,6-dibromo-4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate |
| Molecular Weight: | 625.11 |
| Molecular Formula: | C23 H17 Br3 N2 O4 |
| Smiles: | Cc1cc(c(c(c1)[Br])OCC(N/N=C/c1ccc(cc1)OC(c1ccc(cc1)[Br])=O)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 6.6228 |
| logD: | 6.6225 |
| logSw: | -5.6935 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.391 |
| InChI Key: | CYGZGZWNGGJIOQ-UHFFFAOYSA-N |