O-{4-[(3-bromophenyl)carbamoyl]phenyl} piperidine-1-carbothioate
Chemical Structure Depiction of
O-{4-[(3-bromophenyl)carbamoyl]phenyl} piperidine-1-carbothioate
O-{4-[(3-bromophenyl)carbamoyl]phenyl} piperidine-1-carbothioate
Compound characteristics
| Compound ID: | 8002-0007 |
| Compound Name: | O-{4-[(3-bromophenyl)carbamoyl]phenyl} piperidine-1-carbothioate |
| Molecular Weight: | 419.34 |
| Molecular Formula: | C19 H19 Br N2 O2 S |
| Smiles: | C1CCN(CC1)C(Oc1ccc(cc1)C(Nc1cccc(c1)[Br])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 5.0782 |
| logD: | 5.0757 |
| logSw: | -5.1521 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.8074 |
| InChI Key: | AYZUIPAEHKQHHD-UHFFFAOYSA-N |