2-bromo-6-{[(2-chlorophenyl)imino]methyl}-4-methylphenol
Chemical Structure Depiction of
2-bromo-6-{[(2-chlorophenyl)imino]methyl}-4-methylphenol
2-bromo-6-{[(2-chlorophenyl)imino]methyl}-4-methylphenol
Compound characteristics
| Compound ID: | 8002-0159 |
| Compound Name: | 2-bromo-6-{[(2-chlorophenyl)imino]methyl}-4-methylphenol |
| Molecular Weight: | 324.6 |
| Molecular Formula: | C14 H11 Br Cl N O |
| Smiles: | Cc1cc(/C=N/c2ccccc2[Cl])c(c(c1)[Br])O |
| Stereo: | ACHIRAL |
| logP: | 4.6575 |
| logD: | 4.4793 |
| logSw: | -4.5207 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.1472 |
| InChI Key: | KRIJHUDDOGINOH-UHFFFAOYSA-N |