4-(4-methoxyphenyl)-6-phenyl-2-[(prop-2-en-1-yl)sulfanyl]pyridine-3-carbonitrile
Chemical Structure Depiction of
4-(4-methoxyphenyl)-6-phenyl-2-[(prop-2-en-1-yl)sulfanyl]pyridine-3-carbonitrile
4-(4-methoxyphenyl)-6-phenyl-2-[(prop-2-en-1-yl)sulfanyl]pyridine-3-carbonitrile
Compound characteristics
| Compound ID: | 8002-1733 |
| Compound Name: | 4-(4-methoxyphenyl)-6-phenyl-2-[(prop-2-en-1-yl)sulfanyl]pyridine-3-carbonitrile |
| Molecular Weight: | 358.46 |
| Molecular Formula: | C22 H18 N2 O S |
| Smiles: | COc1ccc(cc1)c1cc(c2ccccc2)nc(c1C#N)SCC=C |
| Stereo: | ACHIRAL |
| logP: | 6.3895 |
| logD: | 6.3895 |
| logSw: | -5.8262 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.042 |
| InChI Key: | DIINUICCGOBNMN-UHFFFAOYSA-N |