N,N'-([1,1'-biphenyl]-4,4'-diyl)bis[1-(2,4,5-trimethoxyphenyl)methanimine]
Chemical Structure Depiction of
N,N'-([1,1'-biphenyl]-4,4'-diyl)bis[1-(2,4,5-trimethoxyphenyl)methanimine]
N,N'-([1,1'-biphenyl]-4,4'-diyl)bis[1-(2,4,5-trimethoxyphenyl)methanimine]
Compound characteristics
| Compound ID: | 8002-1791 |
| Compound Name: | N,N'-([1,1'-biphenyl]-4,4'-diyl)bis[1-(2,4,5-trimethoxyphenyl)methanimine] |
| Molecular Weight: | 540.62 |
| Molecular Formula: | C32 H32 N2 O6 |
| Smiles: | COc1cc(c(cc1/C=N/c1ccc(cc1)c1ccc(cc1)/N=C/c1cc(c(cc1OC)OC)OC)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 5.3768 |
| logD: | 5.356 |
| logSw: | -5.6441 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 62.004 |
| InChI Key: | MXVBJRKACYJQLA-UHFFFAOYSA-N |