N-(2-hydroxyethyl)-2-[1-methyl-3-(phenylsulfanyl)-1H-indol-2-yl]acetamide
Chemical Structure Depiction of
N-(2-hydroxyethyl)-2-[1-methyl-3-(phenylsulfanyl)-1H-indol-2-yl]acetamide
N-(2-hydroxyethyl)-2-[1-methyl-3-(phenylsulfanyl)-1H-indol-2-yl]acetamide
Compound characteristics
| Compound ID: | 8002-1831 |
| Compound Name: | N-(2-hydroxyethyl)-2-[1-methyl-3-(phenylsulfanyl)-1H-indol-2-yl]acetamide |
| Molecular Weight: | 340.44 |
| Molecular Formula: | C19 H20 N2 O2 S |
| Smiles: | Cn1c(CC(NCCO)=O)c(c2ccccc12)Sc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.2646 |
| logD: | 2.2646 |
| logSw: | -2.593 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.728 |
| InChI Key: | UBQRFZPGEZMWSR-UHFFFAOYSA-N |