2-(2-bromo-4-methylphenoxy)-N'-[(6-chloro-2H-1,3-benzodioxol-5-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(2-bromo-4-methylphenoxy)-N'-[(6-chloro-2H-1,3-benzodioxol-5-yl)methylidene]acetohydrazide
2-(2-bromo-4-methylphenoxy)-N'-[(6-chloro-2H-1,3-benzodioxol-5-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8002-3704 |
| Compound Name: | 2-(2-bromo-4-methylphenoxy)-N'-[(6-chloro-2H-1,3-benzodioxol-5-yl)methylidene]acetohydrazide |
| Molecular Weight: | 425.66 |
| Molecular Formula: | C17 H14 Br Cl N2 O4 |
| Smiles: | Cc1ccc(c(c1)[Br])OCC(N/N=C/c1cc2c(cc1[Cl])OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5074 |
| logD: | 4.5063 |
| logSw: | -4.5719 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.042 |
| InChI Key: | ZNTQGZFYXLMEJM-IFRROFPPSA-N |