2-(3-nitro-1H-1,2,4-triazol-1-yl)-1-(thiophen-2-yl)ethan-1-one
Chemical Structure Depiction of
2-(3-nitro-1H-1,2,4-triazol-1-yl)-1-(thiophen-2-yl)ethan-1-one
2-(3-nitro-1H-1,2,4-triazol-1-yl)-1-(thiophen-2-yl)ethan-1-one
Compound characteristics
| Compound ID: | 8002-4111 |
| Compound Name: | 2-(3-nitro-1H-1,2,4-triazol-1-yl)-1-(thiophen-2-yl)ethan-1-one |
| Molecular Weight: | 238.22 |
| Molecular Formula: | C8 H6 N4 O3 S |
| Smiles: | C(C(c1cccs1)=O)n1cnc(n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.0449 |
| logD: | 1.0449 |
| logSw: | -2.2605 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 70.9 |
| InChI Key: | GFXFAGAEKYLMNV-UHFFFAOYSA-N |