2-(4-chlorophenoxy)-N-(2,6-dibromo-4-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-(4-chlorophenoxy)-N-(2,6-dibromo-4-methoxyphenyl)acetamide
2-(4-chlorophenoxy)-N-(2,6-dibromo-4-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | 8002-5340 |
| Compound Name: | 2-(4-chlorophenoxy)-N-(2,6-dibromo-4-methoxyphenyl)acetamide |
| Molecular Weight: | 449.52 |
| Molecular Formula: | C15 H12 Br2 Cl N O3 |
| Smiles: | COc1cc(c(c(c1)[Br])NC(COc1ccc(cc1)[Cl])=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.5225 |
| logD: | 4.5221 |
| logSw: | -4.6105 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.764 |
| InChI Key: | FHVXHOFVFJRMQG-UHFFFAOYSA-N |