4-methyl-3-[(2-methyl-5-nitrophenyl)sulfamoyl]-N-phenylbenzamide
Chemical Structure Depiction of
4-methyl-3-[(2-methyl-5-nitrophenyl)sulfamoyl]-N-phenylbenzamide
4-methyl-3-[(2-methyl-5-nitrophenyl)sulfamoyl]-N-phenylbenzamide
Compound characteristics
| Compound ID: | 8002-7241 |
| Compound Name: | 4-methyl-3-[(2-methyl-5-nitrophenyl)sulfamoyl]-N-phenylbenzamide |
| Molecular Weight: | 425.46 |
| Molecular Formula: | C21 H19 N3 O5 S |
| Smiles: | Cc1ccc(cc1NS(c1cc(ccc1C)C(Nc1ccccc1)=O)(=O)=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.1722 |
| logD: | 1.9518 |
| logSw: | -4.2563 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 96.663 |
| InChI Key: | ZNBJRQXUBMZTFJ-UHFFFAOYSA-N |