N~1~-butyl-N~2~-(4-ethylphenyl)ethanediamide
Chemical Structure Depiction of
N~1~-butyl-N~2~-(4-ethylphenyl)ethanediamide
N~1~-butyl-N~2~-(4-ethylphenyl)ethanediamide
Compound characteristics
| Compound ID: | 8002-7632 |
| Compound Name: | N~1~-butyl-N~2~-(4-ethylphenyl)ethanediamide |
| Molecular Weight: | 248.32 |
| Molecular Formula: | C14 H20 N2 O2 |
| Smiles: | CCCCNC(C(Nc1ccc(CC)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9279 |
| logD: | 2.8077 |
| logSw: | -3.3084 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.127 |
| InChI Key: | TUCQOKDRCXGYFW-UHFFFAOYSA-N |