3-(4-bromobenzene-1-sulfonyl)-N,N-dibutylbenzene-1-sulfonamide
Chemical Structure Depiction of
3-(4-bromobenzene-1-sulfonyl)-N,N-dibutylbenzene-1-sulfonamide
3-(4-bromobenzene-1-sulfonyl)-N,N-dibutylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8002-7869 |
| Compound Name: | 3-(4-bromobenzene-1-sulfonyl)-N,N-dibutylbenzene-1-sulfonamide |
| Molecular Weight: | 488.46 |
| Molecular Formula: | C20 H26 Br N O4 S2 |
| Smiles: | CCCCN(CCCC)S(c1cccc(c1)S(c1ccc(cc1)[Br])(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.882 |
| logD: | 5.882 |
| logSw: | -5.4845 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 61.343 |
| InChI Key: | GYTHBEFJPGLFFT-UHFFFAOYSA-N |