2-(4-chlorophenoxy)-N'-[(naphthalen-1-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(4-chlorophenoxy)-N'-[(naphthalen-1-yl)methylidene]acetohydrazide
2-(4-chlorophenoxy)-N'-[(naphthalen-1-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8002-8943 |
| Compound Name: | 2-(4-chlorophenoxy)-N'-[(naphthalen-1-yl)methylidene]acetohydrazide |
| Molecular Weight: | 338.79 |
| Molecular Formula: | C19 H15 Cl N2 O2 |
| Smiles: | C(C(N/N=C/c1cccc2ccccc12)=O)Oc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.8011 |
| logD: | 4.8009 |
| logSw: | -5.1655 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.568 |
| InChI Key: | NLTQCYJYHXVGPC-UHFFFAOYSA-N |