N-butyl-N-ethyl-4-nitro-2-{[2-(4-nitrophenyl)hydrazinylidene]methyl}aniline
Chemical Structure Depiction of
N-butyl-N-ethyl-4-nitro-2-{[2-(4-nitrophenyl)hydrazinylidene]methyl}aniline
N-butyl-N-ethyl-4-nitro-2-{[2-(4-nitrophenyl)hydrazinylidene]methyl}aniline
Compound characteristics
| Compound ID: | 8002-9267 |
| Compound Name: | N-butyl-N-ethyl-4-nitro-2-{[2-(4-nitrophenyl)hydrazinylidene]methyl}aniline |
| Molecular Weight: | 385.42 |
| Molecular Formula: | C19 H23 N5 O4 |
| Smiles: | CCCCN(CC)c1ccc(cc1/C=N/Nc1ccc(cc1)[N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4864 |
| logD: | 5.4863 |
| logSw: | -5.49 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 90.827 |
| InChI Key: | FEVZSGQVVJCKTO-UHFFFAOYSA-N |