N'-{[5-(2,5-dichlorophenyl)furan-2-yl]methylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
Chemical Structure Depiction of
N'-{[5-(2,5-dichlorophenyl)furan-2-yl]methylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
N'-{[5-(2,5-dichlorophenyl)furan-2-yl]methylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
Compound characteristics
| Compound ID: | 8002-9621 |
| Compound Name: | N'-{[5-(2,5-dichlorophenyl)furan-2-yl]methylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide |
| Molecular Weight: | 501.45 |
| Molecular Formula: | C27 H30 Cl2 N2 O3 |
| Smiles: | CC(C)(C)CC(C)(C)c1ccc(cc1)OCC(N/N=C/c1ccc(c2cc(ccc2[Cl])[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 8.585 |
| logD: | 8.5849 |
| logSw: | -6.5644 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.41 |
| InChI Key: | OTKORCBYPNIUNY-UHFFFAOYSA-N |