5-{[4-(morpholin-4-yl)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-{[4-(morpholin-4-yl)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
5-{[4-(morpholin-4-yl)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 8003-0100 |
| Compound Name: | 5-{[4-(morpholin-4-yl)phenyl]methylidene}-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 301.3 |
| Molecular Formula: | C15 H15 N3 O4 |
| Smiles: | C1COCCN1c1ccc(C=C2C(NC(NC2=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 0.6019 |
| logD: | 0.2547 |
| logSw: | -1.9458 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.004 |
| InChI Key: | SQEVUYLZKJPAGZ-UHFFFAOYSA-N |