4-chloro-3,5-dimethyl-2-nitro-6-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenol
Chemical Structure Depiction of
4-chloro-3,5-dimethyl-2-nitro-6-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenol
4-chloro-3,5-dimethyl-2-nitro-6-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenol
Compound characteristics
| Compound ID: | 8003-0180 |
| Compound Name: | 4-chloro-3,5-dimethyl-2-nitro-6-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenol |
| Molecular Weight: | 421.84 |
| Molecular Formula: | C22 H16 Cl N3 O4 |
| Smiles: | Cc1c(/C=N/c2ccc3c(c2)nc(c2ccccc2)o3)c(c(c(C)c1[Cl])[N+]([O-])=O)O |
| Stereo: | ACHIRAL |
| logP: | 6.0967 |
| logD: | 4.3167 |
| logSw: | -5.8542 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.435 |
| InChI Key: | SLFFLEGYPRJDJG-UHFFFAOYSA-N |