N'-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
Chemical Structure Depiction of
N'-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
N'-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
Compound characteristics
| Compound ID: | 8003-0876 |
| Compound Name: | N'-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide |
| Molecular Weight: | 428.28 |
| Molecular Formula: | C20 H18 Br N3 O3 |
| Smiles: | COc1cc(/C=N/NC(CNc2ccc3ccccc3c2)=O)cc(c1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.2135 |
| logD: | 4.1646 |
| logSw: | -4.1965 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 68.685 |
| InChI Key: | VSSUNCCZQJADIF-UHFFFAOYSA-N |