4-chloro-N-(2-{2-[1-(4-fluorophenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
Chemical Structure Depiction of
4-chloro-N-(2-{2-[1-(4-fluorophenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
4-chloro-N-(2-{2-[1-(4-fluorophenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | 8003-1209 |
| Compound Name: | 4-chloro-N-(2-{2-[1-(4-fluorophenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide |
| Molecular Weight: | 347.77 |
| Molecular Formula: | C17 H15 Cl F N3 O2 |
| Smiles: | C\C(c1ccc(cc1)F)=N/NC(CNC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3986 |
| logD: | 3.3984 |
| logSw: | -4.0041 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.313 |
| InChI Key: | XSMSYIFGFIQTEH-UHFFFAOYSA-N |