4-chloro-N-(2-{2-[(furan-2-yl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
Chemical Structure Depiction of
4-chloro-N-(2-{2-[(furan-2-yl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
4-chloro-N-(2-{2-[(furan-2-yl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | 8003-1283 |
| Compound Name: | 4-chloro-N-(2-{2-[(furan-2-yl)methylidene]hydrazinyl}-2-oxoethyl)benzamide |
| Molecular Weight: | 305.72 |
| Molecular Formula: | C14 H12 Cl N3 O3 |
| Smiles: | C(C(N/N=C/c1ccco1)=O)NC(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.5999 |
| logD: | 2.5999 |
| logSw: | -3.4533 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.774 |
| InChI Key: | VTDIWYMLKAUHCQ-UHFFFAOYSA-N |