N'-(5,7-dibromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-(naphthalen-2-yl)acetohydrazide
Chemical Structure Depiction of
N'-(5,7-dibromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-(naphthalen-2-yl)acetohydrazide
N'-(5,7-dibromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-(naphthalen-2-yl)acetohydrazide
Compound characteristics
| Compound ID: | 8003-1641 |
| Compound Name: | N'-(5,7-dibromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-(naphthalen-2-yl)acetohydrazide |
| Molecular Weight: | 487.15 |
| Molecular Formula: | C20 H13 Br2 N3 O2 |
| Smiles: | C(C(N/N=C1C(Nc2c\1cc(cc2[Br])[Br])=O)=O)c1ccc2ccccc2c1 |
| Stereo: | ACHIRAL |
| logP: | 4.9556 |
| logD: | 4.4098 |
| logSw: | -5.4267 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.627 |
| InChI Key: | DRJPLJKULNRNIJ-UHFFFAOYSA-N |