2-(3,4-dimethylphenoxy)-N'-[1-(4-methoxy-3-nitrophenyl)ethylidene]acetohydrazide
Chemical Structure Depiction of
2-(3,4-dimethylphenoxy)-N'-[1-(4-methoxy-3-nitrophenyl)ethylidene]acetohydrazide
2-(3,4-dimethylphenoxy)-N'-[1-(4-methoxy-3-nitrophenyl)ethylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8003-1657 |
| Compound Name: | 2-(3,4-dimethylphenoxy)-N'-[1-(4-methoxy-3-nitrophenyl)ethylidene]acetohydrazide |
| Molecular Weight: | 371.39 |
| Molecular Formula: | C19 H21 N3 O5 |
| Smiles: | C/C(c1ccc(c(c1)[N+]([O-])=O)OC)=N/NC(COc1ccc(C)c(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6944 |
| logD: | 3.6936 |
| logSw: | -4.05 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.839 |
| InChI Key: | MTPOWOJFQFOERW-UHFFFAOYSA-N |