[2,4-dibromo-6-({2-[(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene}methyl)phenoxy]acetic acid
Chemical Structure Depiction of
[2,4-dibromo-6-({2-[(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene}methyl)phenoxy]acetic acid
[2,4-dibromo-6-({2-[(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene}methyl)phenoxy]acetic acid
Compound characteristics
| Compound ID: | 8003-1681 |
| Compound Name: | [2,4-dibromo-6-({2-[(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene}methyl)phenoxy]acetic acid |
| Molecular Weight: | 673.93 |
| Molecular Formula: | C18 H14 Br4 N2 O6 |
| Smiles: | COc1cc(cc(c1OCC(N/N=C/c1cc(cc(c1OCC(O)=O)[Br])[Br])=O)[Br])[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.6502 |
| logD: | 1.4133 |
| logSw: | -5.2323 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.7 |
| InChI Key: | NEWRTTDQJCBPTJ-UHFFFAOYSA-N |