N'-{[2-(hexyloxy)phenyl]methylidene}-2-(4-methylphenyl)acetohydrazide
Chemical Structure Depiction of
N'-{[2-(hexyloxy)phenyl]methylidene}-2-(4-methylphenyl)acetohydrazide
N'-{[2-(hexyloxy)phenyl]methylidene}-2-(4-methylphenyl)acetohydrazide
Compound characteristics
| Compound ID: | 8003-1876 |
| Compound Name: | N'-{[2-(hexyloxy)phenyl]methylidene}-2-(4-methylphenyl)acetohydrazide |
| Molecular Weight: | 352.48 |
| Molecular Formula: | C22 H28 N2 O2 |
| Smiles: | CCCCCCOc1ccccc1\C=N/NC(Cc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.219 |
| logD: | 6.2187 |
| logSw: | -5.2764 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.845 |
| InChI Key: | RQOJFIUFKSDERR-UHFFFAOYSA-N |