O-{3-[(4-bromophenyl)carbamoyl]phenyl} diethylcarbamothioate
Chemical Structure Depiction of
O-{3-[(4-bromophenyl)carbamoyl]phenyl} diethylcarbamothioate
O-{3-[(4-bromophenyl)carbamoyl]phenyl} diethylcarbamothioate
Compound characteristics
| Compound ID: | 8003-2373 |
| Compound Name: | O-{3-[(4-bromophenyl)carbamoyl]phenyl} diethylcarbamothioate |
| Molecular Weight: | 407.33 |
| Molecular Formula: | C18 H19 Br N2 O2 S |
| Smiles: | CCN(CC)C(Oc1cccc(c1)C(Nc1ccc(cc1)[Br])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 4.9075 |
| logD: | 4.9001 |
| logSw: | -4.6747 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.0912 |
| InChI Key: | HZDRTSMHCLHVSA-UHFFFAOYSA-N |