N-(4-iodophenyl)naphthalene-2-sulfonamide
Chemical Structure Depiction of
N-(4-iodophenyl)naphthalene-2-sulfonamide
N-(4-iodophenyl)naphthalene-2-sulfonamide
Compound characteristics
| Compound ID: | 8003-2903 |
| Compound Name: | N-(4-iodophenyl)naphthalene-2-sulfonamide |
| Molecular Weight: | 409.24 |
| Molecular Formula: | C16 H12 I N O2 S |
| Smiles: | c1ccc2cc(ccc2c1)S(Nc1ccc(cc1)I)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1991 |
| logD: | 4.1281 |
| logSw: | -6.3052 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.616 |
| InChI Key: | LDCISOXMVRSGSO-UHFFFAOYSA-N |