2-{2-[(3-methoxyphenyl)methylidene]hydrazinyl}-2-oxo-N-(1-phenylethyl)acetamide
Chemical Structure Depiction of
2-{2-[(3-methoxyphenyl)methylidene]hydrazinyl}-2-oxo-N-(1-phenylethyl)acetamide
2-{2-[(3-methoxyphenyl)methylidene]hydrazinyl}-2-oxo-N-(1-phenylethyl)acetamide
Compound characteristics
| Compound ID: | 8003-3272 |
| Compound Name: | 2-{2-[(3-methoxyphenyl)methylidene]hydrazinyl}-2-oxo-N-(1-phenylethyl)acetamide |
| Molecular Weight: | 325.37 |
| Molecular Formula: | C18 H19 N3 O3 |
| Smiles: | CC(c1ccccc1)NC(C(N/N=C/c1cccc(c1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5943 |
| logD: | 1.7538 |
| logSw: | -3.0594 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.946 |
| InChI Key: | UQURQHJRBRWRER-ZDUSSCGKSA-N |