propan-2-yl 2-amino-4-(4-chlorophenyl)-5-oxo-5,6,7,8-tetrahydro-4H-1-benzopyran-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 2-amino-4-(4-chlorophenyl)-5-oxo-5,6,7,8-tetrahydro-4H-1-benzopyran-3-carboxylate
propan-2-yl 2-amino-4-(4-chlorophenyl)-5-oxo-5,6,7,8-tetrahydro-4H-1-benzopyran-3-carboxylate
Compound characteristics
| Compound ID: | 8003-3594 |
| Compound Name: | propan-2-yl 2-amino-4-(4-chlorophenyl)-5-oxo-5,6,7,8-tetrahydro-4H-1-benzopyran-3-carboxylate |
| Molecular Weight: | 361.82 |
| Molecular Formula: | C19 H20 Cl N O4 |
| Smiles: | CC(C)OC(C1C(C2=C(CCCC2=O)OC=1N)c1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3312 |
| logD: | 3.3312 |
| logSw: | -4.1994 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.979 |
| InChI Key: | AMTVVNONABPDKN-OAHLLOKOSA-N |