1-(2,4-dinitrophenyl)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazine
Chemical Structure Depiction of
1-(2,4-dinitrophenyl)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazine
1-(2,4-dinitrophenyl)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazine
Compound characteristics
| Compound ID: | 8003-4770 |
| Compound Name: | 1-(2,4-dinitrophenyl)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazine |
| Molecular Weight: | 375.3 |
| Molecular Formula: | C15 H13 N5 O7 |
| Smiles: | C\C(c1ccc(c(c1)[N+]([O-])=O)OC)=N/Nc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8541 |
| logD: | 3.8474 |
| logSw: | -4.1363 |
| Hydrogen bond acceptors count: | 14 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 127.138 |
| InChI Key: | SNGOGHJPTYIINA-UHFFFAOYSA-N |