2-{[(2-methylphenyl)methyl]sulfanyl}-N'-[(4-nitrophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-{[(2-methylphenyl)methyl]sulfanyl}-N'-[(4-nitrophenyl)methylidene]acetohydrazide
2-{[(2-methylphenyl)methyl]sulfanyl}-N'-[(4-nitrophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8003-5841 |
| Compound Name: | 2-{[(2-methylphenyl)methyl]sulfanyl}-N'-[(4-nitrophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 343.4 |
| Molecular Formula: | C17 H17 N3 O3 S |
| Smiles: | Cc1ccccc1CSCC(N/N=C/c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3285 |
| logD: | 4.3264 |
| logSw: | -4.2922 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.722 |
| InChI Key: | UBBLDHFBDMMNCY-UHFFFAOYSA-N |