diethyl {[(6-methylpyridin-2-yl)amino]methylidene}propanedioate
Chemical Structure Depiction of
diethyl {[(6-methylpyridin-2-yl)amino]methylidene}propanedioate
diethyl {[(6-methylpyridin-2-yl)amino]methylidene}propanedioate
Compound characteristics
| Compound ID: | 8003-7327 |
| Compound Name: | diethyl {[(6-methylpyridin-2-yl)amino]methylidene}propanedioate |
| Molecular Weight: | 278.31 |
| Molecular Formula: | C14 H18 N2 O4 |
| Smiles: | CCOC(C(=CNc1cccc(C)n1)C(=O)OCC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.467 |
| logD: | 0.8715 |
| logSw: | -2.543 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.336 |
| InChI Key: | IAXFBMUDERBERN-UHFFFAOYSA-N |