2-[(1,3-benzoxazol-2-yl)sulfanyl]-N'-[(4-bromophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(1,3-benzoxazol-2-yl)sulfanyl]-N'-[(4-bromophenyl)methylidene]acetohydrazide
2-[(1,3-benzoxazol-2-yl)sulfanyl]-N'-[(4-bromophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8003-7379 |
| Compound Name: | 2-[(1,3-benzoxazol-2-yl)sulfanyl]-N'-[(4-bromophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 390.26 |
| Molecular Formula: | C16 H12 Br N3 O2 S |
| Smiles: | C(C(N/N=C/c1ccc(cc1)[Br])=O)Sc1nc2ccccc2o1 |
| Stereo: | ACHIRAL |
| logP: | 4.3231 |
| logD: | 4.3229 |
| logSw: | -4.4132 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.004 |
| InChI Key: | OKNQPDQZVUJUJC-UHFFFAOYSA-N |