6-amino-4-(2,4-dimethoxyphenyl)-2,3,3a,4-tetrahydro-5H-indene-5,5,7-tricarbonitrile
Chemical Structure Depiction of
6-amino-4-(2,4-dimethoxyphenyl)-2,3,3a,4-tetrahydro-5H-indene-5,5,7-tricarbonitrile
6-amino-4-(2,4-dimethoxyphenyl)-2,3,3a,4-tetrahydro-5H-indene-5,5,7-tricarbonitrile
Compound characteristics
| Compound ID: | 8003-8217 |
| Compound Name: | 6-amino-4-(2,4-dimethoxyphenyl)-2,3,3a,4-tetrahydro-5H-indene-5,5,7-tricarbonitrile |
| Molecular Weight: | 346.39 |
| Molecular Formula: | C20 H18 N4 O2 |
| Smiles: | COc1ccc(C2C3CCC=C3C(C#N)=C(C2(C#N)C#N)N)c(c1)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.806 |
| logD: | 2.8058 |
| logSw: | -3.1382 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.895 |
| InChI Key: | SBIMLFLLINPJFB-UHFFFAOYSA-N |