N-(3-chlorophenyl)-2-{2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl}-2-oxoacetamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-{2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl}-2-oxoacetamide
N-(3-chlorophenyl)-2-{2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl}-2-oxoacetamide
Compound characteristics
| Compound ID: | 8003-8836 |
| Compound Name: | N-(3-chlorophenyl)-2-{2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl}-2-oxoacetamide |
| Molecular Weight: | 361.78 |
| Molecular Formula: | C17 H16 Cl N3 O4 |
| Smiles: | COc1ccc(c(/C=N/NC(C(Nc2cccc(c2)[Cl])=O)=O)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.6432 |
| logD: | 1.5154 |
| logSw: | -4.0337 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.091 |
| InChI Key: | CNRCKVVDNGZCBD-UHFFFAOYSA-N |