4,6-bis{2-[(2,4-dichlorophenyl)methylidene]hydrazinyl}-N,N-diphenyl-1,3,5-triazin-2-amine
Chemical Structure Depiction of
4,6-bis{2-[(2,4-dichlorophenyl)methylidene]hydrazinyl}-N,N-diphenyl-1,3,5-triazin-2-amine
4,6-bis{2-[(2,4-dichlorophenyl)methylidene]hydrazinyl}-N,N-diphenyl-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8003-9572 |
| Compound Name: | 4,6-bis{2-[(2,4-dichlorophenyl)methylidene]hydrazinyl}-N,N-diphenyl-1,3,5-triazin-2-amine |
| Molecular Weight: | 622.34 |
| Molecular Formula: | C29 H20 Cl4 N8 |
| Smiles: | C(\c1ccc(cc1[Cl])[Cl])=N/Nc1nc(N/N=C/c2ccc(cc2[Cl])[Cl])nc(n1)N(c1ccccc1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 10.5705 |
| logD: | 10.5704 |
| logSw: | -7.0476 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.249 |
| InChI Key: | GZPUUIVMTSLCMH-UHFFFAOYSA-N |