N-(3-iodophenyl)-3-(2-pentanoylhydrazinylidene)butanamide
Chemical Structure Depiction of
N-(3-iodophenyl)-3-(2-pentanoylhydrazinylidene)butanamide
N-(3-iodophenyl)-3-(2-pentanoylhydrazinylidene)butanamide
Compound characteristics
| Compound ID: | 8003-9654 |
| Compound Name: | N-(3-iodophenyl)-3-(2-pentanoylhydrazinylidene)butanamide |
| Molecular Weight: | 401.25 |
| Molecular Formula: | C15 H20 I N3 O2 |
| Smiles: | CCCCC(N/N=C(\C)CC(Nc1cccc(c1)I)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.407 |
| logD: | 3.4066 |
| logSw: | -3.5215 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.13 |
| InChI Key: | CXCXFKXYBQFJFH-UHFFFAOYSA-N |