N'-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
Chemical Structure Depiction of
N'-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
N'-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8003-9760 |
| Compound Name: | N'-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide |
| Molecular Weight: | 496.97 |
| Molecular Formula: | C15 H10 Br2 Cl2 N2 O3 |
| Smiles: | C(C(N/N=C/c1cc(c(c(c1)[Br])O)[Br])=O)Oc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6388 |
| logD: | 4.3399 |
| logSw: | -4.558 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.406 |
| InChI Key: | UHKJHLLESUEQPU-UHFFFAOYSA-N |